ChemNet > CAS > 499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
termék neve |
methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate |
Szinonimák |
methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
MF |
C12H15N3O2S |
Molekulatömeg |
265.3314 |
InChI |
InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
CAS-szám |
499771-09-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.33g/cm3 |
Olvadáspont |
183℃ |
Forráspont |
506.1°C at 760 mmHg |
Törésmutató |
1.613 |
Gyulladáspont |
259.9°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|